C12H18ClFN2O3S — CID 119960633
3-fluoro-4-methoxy-N-piperidin-4-ylbenzenesulfonamide;hydrochloride (PubChem CID 119960633) has the molecular formula C12H18ClFN2O3S and a molecular weight of 324.81 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-piperidin-4-ylbenzenesulfonamide;hydrochloride.
| Compound Name | 3-fluoro-4-methoxy-N-piperidin-4-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119960633 |
| Molecular Formula | C12H18ClFN2O3S |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 3-fluoro-4-methoxy-N-piperidin-4-ylbenzenesulfonamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)NC2CCNCC2)cc1F.Cl |
| InChI | InChI=1S/C12H17FN2O3S.ClH/c1-18-12-3-2-10(8-11(12)13)19(16,17)15-9-4-6-14-7-5-9;/h2-3,8-9,14-15H,4-7H2,1H3;1H |
| InChIKey | JLOFEDBSAOHTJH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |