C16H22N4O5S — CID 119960766
4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-piperidin-4-ylbenzenesulfonamide (PubChem CID 119960766) has the molecular formula C16H22N4O5S and a molecular weight of 382.44 g/mol. Its IUPAC name is 4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-piperidin-4-ylbenzenesulfonamide.
| Compound Name | 4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-piperidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 119960766 |
| Molecular Formula | C16H22N4O5S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-piperidin-4-ylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCNCC2)cc1C1(C)NC(=O)NC1=O |
| InChI | InChI=1S/C16H22N4O5S/c1-16(14(21)18-15(22)19-16)12-9-11(3-4-13(12)25-2)26(23,24)20-10-5-7-17-8-6-10/h3-4,9-10,17,20H,5-8H2,1-2H3,(H2,18,19,21,22) |
| InChIKey | RQUIXAKNIKGAQD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|