C17H24N4O5S — CID 119968701
4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(piperidin-3-ylmethyl)benzenesulfonamide (PubChem CID 119968701) has the molecular formula C17H24N4O5S and a molecular weight of 396.47 g/mol. Its IUPAC name is 4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(piperidin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(piperidin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119968701 |
| Molecular Formula | C17H24N4O5S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 4-methoxy-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(piperidin-3-ylmethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC2CCCNC2)cc1C1(C)NC(=O)NC1=O |
| InChI | InChI=1S/C17H24N4O5S/c1-17(15(22)20-16(23)21-17)13-8-12(5-6-14(13)26-2)27(24,25)19-10-11-4-3-7-18-9-11/h5-6,8,11,18-19H,3-4,7,9-10H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | OIHLBUNGZQSKAC-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|