C13H21ClN2O4S2 — CID 119968466
4-methylsulfonyl-N-(piperidin-3-ylmethyl)benzenesulfonamide;hydrochloride (PubChem CID 119968466) has the molecular formula C13H21ClN2O4S2 and a molecular weight of 368.91 g/mol. Its IUPAC name is 4-methylsulfonyl-N-(piperidin-3-ylmethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 4-methylsulfonyl-N-(piperidin-3-ylmethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119968466 |
| Molecular Formula | C13H21ClN2O4S2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-methylsulfonyl-N-(piperidin-3-ylmethyl)benzenesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)NCC2CCCNC2)cc1.Cl |
| InChI | InChI=1S/C13H20N2O4S2.ClH/c1-20(16,17)12-4-6-13(7-5-12)21(18,19)15-10-11-3-2-8-14-9-11;/h4-7,11,14-15H,2-3,8-10H2,1H3;1H |
| InChIKey | RNLBCNABWLTPKW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |