C17H28N2O2S — CID 119968622
4-(3-methylbutyl)-N-(piperidin-3-ylmethyl)benzenesulfonamide (PubChem CID 119968622) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 4-(3-methylbutyl)-N-(piperidin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(3-methylbutyl)-N-(piperidin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119968622 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 4-(3-methylbutyl)-N-(piperidin-3-ylmethyl)benzenesulfonamide |
| SMILES | CC(C)CCc1ccc(S(=O)(=O)NCC2CCCNC2)cc1 |
| InChI | InChI=1S/C17H28N2O2S/c1-14(2)5-6-15-7-9-17(10-8-15)22(20,21)19-13-16-4-3-11-18-12-16/h7-10,14,16,18-19H,3-6,11-13H2,1-2H3 |
| InChIKey | XAXNMRVSOHKOPL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |