C12H17FN2O4S2 — CID 80562570
2-fluoro-5-methylsulfonyl-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide (PubChem CID 80562570) has the molecular formula C12H17FN2O4S2 and a molecular weight of 336.41 g/mol. Its IUPAC name is 2-fluoro-5-methylsulfonyl-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2-fluoro-5-methylsulfonyl-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 80562570 |
| Molecular Formula | C12H17FN2O4S2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-fluoro-5-methylsulfonyl-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)NCC2CCNC2)c1 |
| InChI | InChI=1S/C12H17FN2O4S2/c1-20(16,17)10-2-3-11(13)12(6-10)21(18,19)15-8-9-4-5-14-7-9/h2-3,6,9,14-15H,4-5,7-8H2,1H3 |
| InChIKey | YTRBYFYZTJZPNQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |