C10H14FN3O2S — CID 80563217
5-fluoro-N-(pyrrolidin-3-ylmethyl)pyridine-3-sulfonamide (PubChem CID 80563217) has the molecular formula C10H14FN3O2S and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-fluoro-N-(pyrrolidin-3-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 5-fluoro-N-(pyrrolidin-3-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 80563217 |
| Molecular Formula | C10H14FN3O2S |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 5-fluoro-N-(pyrrolidin-3-ylmethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC1CCNC1)c1cncc(F)c1 |
| InChI | InChI=1S/C10H14FN3O2S/c11-9-3-10(7-13-6-9)17(15,16)14-5-8-1-2-12-4-8/h3,6-8,12,14H,1-2,4-5H2 |
| InChIKey | KICYSWGDRZXWNS-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |