C12H16BrFN2O2S — CID 106136168
N-[(4-bromocyclohexyl)methyl]-5-fluoropyridine-3-sulfonamide (PubChem CID 106136168) has the molecular formula C12H16BrFN2O2S and a molecular weight of 351.24 g/mol. Its IUPAC name is N-[(4-bromocyclohexyl)methyl]-5-fluoropyridine-3-sulfonamide.
| Compound Name | N-[(4-bromocyclohexyl)methyl]-5-fluoropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106136168 |
| Molecular Formula | C12H16BrFN2O2S |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | N-[(4-bromocyclohexyl)methyl]-5-fluoropyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC1CCC(Br)CC1)c1cncc(F)c1 |
| InChI | InChI=1S/C12H16BrFN2O2S/c13-10-3-1-9(2-4-10)6-16-19(17,18)12-5-11(14)7-15-8-12/h5,7-10,16H,1-4,6H2 |
| InChIKey | HZCKAXYOHHZXGG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|