C13H15BrF3NO2S — CID 106136131
N-[(4-bromocyclohexyl)methyl]-2,4,6-trifluorobenzenesulfonamide (PubChem CID 106136131) has the molecular formula C13H15BrF3NO2S and a molecular weight of 386.23 g/mol. Its IUPAC name is N-[(4-bromocyclohexyl)methyl]-2,4,6-trifluorobenzenesulfonamide.
| Compound Name | N-[(4-bromocyclohexyl)methyl]-2,4,6-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106136131 |
| Molecular Formula | C13H15BrF3NO2S |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | N-[(4-bromocyclohexyl)methyl]-2,4,6-trifluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCC(Br)CC1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H15BrF3NO2S/c14-9-3-1-8(2-4-9)7-18-21(19,20)13-11(16)5-10(15)6-12(13)17/h5-6,8-9,18H,1-4,7H2 |
| InChIKey | FYLCGLPRYCIRIV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|