C10H13FN4O4S — CID 60985987
N-(cyclopropylmethyl)-2-fluoro-6-hydrazinyl-4-nitrobenzenesulfonamide (PubChem CID 60985987) has the molecular formula C10H13FN4O4S and a molecular weight of 304.30 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-fluoro-6-hydrazinyl-4-nitrobenzenesulfonamide.
| Compound Name | N-(cyclopropylmethyl)-2-fluoro-6-hydrazinyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 60985987 |
| Molecular Formula | C10H13FN4O4S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-(cyclopropylmethyl)-2-fluoro-6-hydrazinyl-4-nitrobenzenesulfonamide |
| SMILES | NNc1cc([N+](=O)[O-])cc(F)c1S(=O)(=O)NCC1CC1 |
| InChI | InChI=1S/C10H13FN4O4S/c11-8-3-7(15(16)17)4-9(14-12)10(8)20(18,19)13-5-6-1-2-6/h3-4,6,13-14H,1-2,5,12H2 |
| InChIKey | GPWPVCGWUKFYCL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|