C10H13FN4O5S — CID 80712583
2-fluoro-6-hydrazinyl-4-nitro-N-(oxolan-3-yl)benzenesulfonamide (PubChem CID 80712583) has the molecular formula C10H13FN4O5S and a molecular weight of 320.30 g/mol. Its IUPAC name is 2-fluoro-6-hydrazinyl-4-nitro-N-(oxolan-3-yl)benzenesulfonamide.
| Compound Name | 2-fluoro-6-hydrazinyl-4-nitro-N-(oxolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 80712583 |
| Molecular Formula | C10H13FN4O5S |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-fluoro-6-hydrazinyl-4-nitro-N-(oxolan-3-yl)benzenesulfonamide |
| SMILES | NNc1cc([N+](=O)[O-])cc(F)c1S(=O)(=O)NC1CCOC1 |
| InChI | InChI=1S/C10H13FN4O5S/c11-8-3-7(15(16)17)4-9(13-12)10(8)21(18,19)14-6-1-2-20-5-6/h3-4,6,13-14H,1-2,5,12H2 |
| InChIKey | HEKRYAHWVSMLFT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|