C11H13FN2O5S — CID 107327305
4-fluoro-2,6-dimethyl-3-nitro-N-(oxetan-3-yl)benzenesulfonamide (PubChem CID 107327305) has the molecular formula C11H13FN2O5S and a molecular weight of 304.30 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethyl-3-nitro-N-(oxetan-3-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-2,6-dimethyl-3-nitro-N-(oxetan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107327305 |
| Molecular Formula | C11H13FN2O5S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-fluoro-2,6-dimethyl-3-nitro-N-(oxetan-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(F)c([N+](=O)[O-])c(C)c1S(=O)(=O)NC1COC1 |
| InChI | InChI=1S/C11H13FN2O5S/c1-6-3-9(12)10(14(15)16)7(2)11(6)20(17,18)13-8-4-19-5-8/h3,8,13H,4-5H2,1-2H3 |
| InChIKey | ORPDZQGWHDSCCQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|