C11H15FN2O5S — CID 107856809
4-fluoro-N-[(2R)-2-hydroxypropyl]-2,6-dimethyl-3-nitrobenzenesulfonamide (PubChem CID 107856809) has the molecular formula C11H15FN2O5S and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-fluoro-N-[(2R)-2-hydroxypropyl]-2,6-dimethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-fluoro-N-[(2R)-2-hydroxypropyl]-2,6-dimethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 107856809 |
| Molecular Formula | C11H15FN2O5S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-fluoro-N-[(2R)-2-hydroxypropyl]-2,6-dimethyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1cc(F)c([N+](=O)[O-])c(C)c1S(=O)(=O)NC[C@@H](C)O |
| InChI | InChI=1S/C11H15FN2O5S/c1-6-4-9(12)10(14(16)17)8(3)11(6)20(18,19)13-5-7(2)15/h4,7,13,15H,5H2,1-3H3/t7-/m1/s1 |
| InChIKey | SAYLJFURPJSNHU-SSDOTTSWSA-N |
| XLogP | 1.01 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|