C11H18N2O3S — CID 43498713
5-amino-N-(2-hydroxypropyl)-2,3-dimethylbenzenesulfonamide (PubChem CID 43498713) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 5-amino-N-(2-hydroxypropyl)-2,3-dimethylbenzenesulfonamide.
| Compound Name | 5-amino-N-(2-hydroxypropyl)-2,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43498713 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 5-amino-N-(2-hydroxypropyl)-2,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(N)cc(S(=O)(=O)NCC(C)O)c1C |
| InChI | InChI=1S/C11H18N2O3S/c1-7-4-10(12)5-11(9(7)3)17(15,16)13-6-8(2)14/h4-5,8,13-14H,6,12H2,1-3H3 |
| InChIKey | WZVHZGKHTOTTQY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|