C12H19NO3S — CID 43845575
N-(2-hydroxypropyl)-2,4,5-trimethylbenzenesulfonamide (PubChem CID 43845575) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-2,4,5-trimethylbenzenesulfonamide.
| Compound Name | N-(2-hydroxypropyl)-2,4,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43845575 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-(2-hydroxypropyl)-2,4,5-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCC(C)O)cc1C |
| InChI | InChI=1S/C12H19NO3S/c1-8-5-10(3)12(6-9(8)2)17(15,16)13-7-11(4)14/h5-6,11,13-14H,7H2,1-4H3 |
| InChIKey | JSSODTJOZAYUEM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |