C11H16ClNO3S — CID 3465021
4-chloro-N-(2-hydroxypropyl)-2,5-dimethylbenzenesulfonamide (PubChem CID 3465021) has the molecular formula C11H16ClNO3S and a molecular weight of 277.77 g/mol. Its IUPAC name is 4-chloro-N-(2-hydroxypropyl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(2-hydroxypropyl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3465021 |
| Molecular Formula | C11H16ClNO3S |
| Molecular Weight | 277.77 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 4-chloro-N-(2-hydroxypropyl)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC(C)O)c(C)cc1Cl |
| InChI | InChI=1S/C11H16ClNO3S/c1-7-5-11(8(2)4-10(7)12)17(15,16)13-6-9(3)14/h4-5,9,13-14H,6H2,1-3H3 |
| InChIKey | MLYKAFKVGDLBAR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.77 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |