C10H13Br2NO3S — CID 83030925
2,5-dibromo-N-[(2S)-2-hydroxypropyl]-4-methylbenzenesulfonamide (PubChem CID 83030925) has the molecular formula C10H13Br2NO3S and a molecular weight of 387.09 g/mol. Its IUPAC name is 2,5-dibromo-N-[(2S)-2-hydroxypropyl]-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[(2S)-2-hydroxypropyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 83030925 |
| Molecular Formula | C10H13Br2NO3S |
| Molecular Weight | 387.09 g/mol |
| Exact Mass | 384.90 |
| IUPAC Name | 2,5-dibromo-N-[(2S)-2-hydroxypropyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NC[C@H](C)O)cc1Br |
| InChI | InChI=1S/C10H13Br2NO3S/c1-6-3-9(12)10(4-8(6)11)17(15,16)13-5-7(2)14/h3-4,7,13-14H,5H2,1-2H3/t7-/m0/s1 |
| InChIKey | CMLJAUDNEVFWCT-ZETCQYMHSA-N |
| XLogP | 2.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.09 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |