C11H14Br2ClNO2S — CID 81327843
2,5-dibromo-N-(3-chloro-2-methylpropyl)-4-methylbenzenesulfonamide (PubChem CID 81327843) has the molecular formula C11H14Br2ClNO2S and a molecular weight of 419.57 g/mol. Its IUPAC name is 2,5-dibromo-N-(3-chloro-2-methylpropyl)-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(3-chloro-2-methylpropyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81327843 |
| Molecular Formula | C11H14Br2ClNO2S |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 416.88 |
| IUPAC Name | 2,5-dibromo-N-(3-chloro-2-methylpropyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NCC(C)CCl)cc1Br |
| InChI | InChI=1S/C11H14Br2ClNO2S/c1-7(5-14)6-15-18(16,17)11-4-9(12)8(2)3-10(11)13/h3-4,7,15H,5-6H2,1-2H3 |
| InChIKey | OKRUCTMNSYVDIY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|