C13H18Br3NO2S — CID 106158589
2,5-dibromo-N-(5-bromo-4-methylpentyl)-4-methylbenzenesulfonamide (PubChem CID 106158589) has the molecular formula C13H18Br3NO2S and a molecular weight of 492.07 g/mol. Its IUPAC name is 2,5-dibromo-N-(5-bromo-4-methylpentyl)-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(5-bromo-4-methylpentyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106158589 |
| Molecular Formula | C13H18Br3NO2S |
| Molecular Weight | 492.07 g/mol |
| Exact Mass | 488.86 |
| IUPAC Name | 2,5-dibromo-N-(5-bromo-4-methylpentyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NCCCC(C)CBr)cc1Br |
| InChI | InChI=1S/C13H18Br3NO2S/c1-9(8-14)4-3-5-17-20(18,19)13-7-11(15)10(2)6-12(13)16/h6-7,9,17H,3-5,8H2,1-2H3 |
| InChIKey | LBAXKAJDYCFAQC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.07 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|