C11H15Br2NO3S — CID 82714913
2,5-dibromo-4-methyl-N-(2-methylpropoxy)benzenesulfonamide (PubChem CID 82714913) has the molecular formula C11H15Br2NO3S and a molecular weight of 401.12 g/mol. Its IUPAC name is 2,5-dibromo-4-methyl-N-(2-methylpropoxy)benzenesulfonamide.
| Compound Name | 2,5-dibromo-4-methyl-N-(2-methylpropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82714913 |
| Molecular Formula | C11H15Br2NO3S |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | 2,5-dibromo-4-methyl-N-(2-methylpropoxy)benzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NOCC(C)C)cc1Br |
| InChI | InChI=1S/C11H15Br2NO3S/c1-7(2)6-17-14-18(15,16)11-5-9(12)8(3)4-10(11)13/h4-5,7,14H,6H2,1-3H3 |
| InChIKey | VIWBKLKUKCZQBL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|