C10H11FN2O5S — CID 113306312
4-fluoro-3-methyl-5-nitro-N-(oxetan-3-yl)benzenesulfonamide (PubChem CID 113306312) has the molecular formula C10H11FN2O5S and a molecular weight of 290.27 g/mol. Its IUPAC name is 4-fluoro-3-methyl-5-nitro-N-(oxetan-3-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-5-nitro-N-(oxetan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113306312 |
| Molecular Formula | C10H11FN2O5S |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-fluoro-3-methyl-5-nitro-N-(oxetan-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2COC2)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C10H11FN2O5S/c1-6-2-8(3-9(10(6)11)13(14)15)19(16,17)12-7-4-18-5-7/h2-3,7,12H,4-5H2,1H3 |
| InChIKey | HEHISBGTTSMTOI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|