C12H17FN2O4S — CID 115421914
N-(2,2-dimethylpropyl)-4-fluoro-3-methyl-5-nitrobenzenesulfonamide (PubChem CID 115421914) has the molecular formula C12H17FN2O4S and a molecular weight of 304.34 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-4-fluoro-3-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(2,2-dimethylpropyl)-4-fluoro-3-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115421914 |
| Molecular Formula | C12H17FN2O4S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-(2,2-dimethylpropyl)-4-fluoro-3-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC(C)(C)C)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C12H17FN2O4S/c1-8-5-9(6-10(11(8)13)15(16)17)20(18,19)14-7-12(2,3)4/h5-6,14H,7H2,1-4H3 |
| InChIKey | WXPMLTVZOFNTMP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|