C12H16FNO3S — CID 99819137
4-fluoro-3,5-dimethyl-N-[(3R)-oxolan-3-yl]benzenesulfonamide (PubChem CID 99819137) has the molecular formula C12H16FNO3S and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-fluoro-3,5-dimethyl-N-[(3R)-oxolan-3-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-3,5-dimethyl-N-[(3R)-oxolan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 99819137 |
| Molecular Formula | C12H16FNO3S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-fluoro-3,5-dimethyl-N-[(3R)-oxolan-3-yl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N[C@@H]2CCOC2)cc(C)c1F |
| InChI | InChI=1S/C12H16FNO3S/c1-8-5-11(6-9(2)12(8)13)18(15,16)14-10-3-4-17-7-10/h5-6,10,14H,3-4,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | KACDBAVJYIDJFI-SNVBAGLBSA-N |
| XLogP | 1.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |