C18H18F2N2O4S — CID 90075345
3-fluoro-N-(4-fluoro-3-methylphenyl)-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide (PubChem CID 90075345) has the molecular formula C18H18F2N2O4S and a molecular weight of 396.42 g/mol. Its IUPAC name is 3-fluoro-N-(4-fluoro-3-methylphenyl)-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide.
| Compound Name | 3-fluoro-N-(4-fluoro-3-methylphenyl)-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 90075345 |
| Molecular Formula | C18H18F2N2O4S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 3-fluoro-N-(4-fluoro-3-methylphenyl)-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2cc(F)cc(S(=O)(=O)N[C@H]3CCOC3)c2)ccc1F |
| InChI | InChI=1S/C18H18F2N2O4S/c1-11-6-14(2-3-17(11)20)21-18(23)12-7-13(19)9-16(8-12)27(24,25)22-15-4-5-26-10-15/h2-3,6-9,15,22H,4-5,10H2,1H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | FHRXTIAWHBCPBW-HNNXBMFYSA-N |
| XLogP | 2.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |