C16H22FN3O4S — CID 140703463
N-(4-fluoro-3-methylphenyl)-1-[[(3S)-oxolan-3-yl]sulfamoyl]pyrrolidine-3-carboxamide (PubChem CID 140703463) has the molecular formula C16H22FN3O4S and a molecular weight of 371.43 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-1-[[(3S)-oxolan-3-yl]sulfamoyl]pyrrolidine-3-carboxamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-1-[[(3S)-oxolan-3-yl]sulfamoyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 140703463 |
| Molecular Formula | C16H22FN3O4S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-1-[[(3S)-oxolan-3-yl]sulfamoyl]pyrrolidine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCN(S(=O)(=O)N[C@H]3CCOC3)C2)ccc1F |
| InChI | InChI=1S/C16H22FN3O4S/c1-11-8-13(2-3-15(11)17)18-16(21)12-4-6-20(9-12)25(22,23)19-14-5-7-24-10-14/h2-3,8,12,14,19H,4-7,9-10H2,1H3,(H,18,21)/t12?,14-/m0/s1 |
| InChIKey | YLNMMYXWNIFVMX-PYMCNQPYSA-N |
| XLogP | 1.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |