C18H19FN2O5S2 — CID 90075154
3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(4-fluoro-3-methylphenyl)benzamide (PubChem CID 90075154) has the molecular formula C18H19FN2O5S2 and a molecular weight of 426.49 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(4-fluoro-3-methylphenyl)benzamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(4-fluoro-3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 90075154 |
| Molecular Formula | C18H19FN2O5S2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(4-fluoro-3-methylphenyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(S(=O)(=O)NC3CCS(=O)(=O)C3)c2)ccc1F |
| InChI | InChI=1S/C18H19FN2O5S2/c1-12-9-14(5-6-17(12)19)20-18(22)13-3-2-4-16(10-13)28(25,26)21-15-7-8-27(23,24)11-15/h2-6,9-10,15,21H,7-8,11H2,1H3,(H,20,22) |
| InChIKey | UYNPUTLYNMASOZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |