C21H21N3O5S2 — CID 40795878
N-[4-[[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]phenyl]-3-pyrrol-1-ylbenzamide (PubChem CID 40795878) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[4-[[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]phenyl]-3-pyrrol-1-ylbenzamide.
| Compound Name | N-[4-[[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]phenyl]-3-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 40795878 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N-[4-[[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]phenyl]-3-pyrrol-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N[C@@H]2CCS(=O)(=O)C2)cc1)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C21H21N3O5S2/c25-21(16-4-3-5-19(14-16)24-11-1-2-12-24)22-17-6-8-20(9-7-17)31(28,29)23-18-10-13-30(26,27)15-18/h1-9,11-12,14,18,23H,10,13,15H2,(H,22,25)/t18-/m1/s1 |
| InChIKey | CGTXPBALIOOKOH-GOSISDBHSA-N |
| XLogP | 2.19 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |