C16H20N4O5S2 — CID 43055240
N-[4-[(1,1-dioxothiolan-3-yl)sulfamoyl]phenyl]-2-pyrazol-1-ylpropanamide (PubChem CID 43055240) has the molecular formula C16H20N4O5S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[4-[(1,1-dioxothiolan-3-yl)sulfamoyl]phenyl]-2-pyrazol-1-ylpropanamide.
| Compound Name | N-[4-[(1,1-dioxothiolan-3-yl)sulfamoyl]phenyl]-2-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 43055240 |
| Molecular Formula | C16H20N4O5S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-[4-[(1,1-dioxothiolan-3-yl)sulfamoyl]phenyl]-2-pyrazol-1-ylpropanamide |
| SMILES | CC(C(=O)Nc1ccc(S(=O)(=O)NC2CCS(=O)(=O)C2)cc1)n1cccn1 |
| InChI | InChI=1S/C16H20N4O5S2/c1-12(20-9-2-8-17-20)16(21)18-13-3-5-15(6-4-13)27(24,25)19-14-7-10-26(22,23)11-14/h2-6,8-9,12,14,19H,7,10-11H2,1H3,(H,18,21) |
| InChIKey | GEVGDAIEZLKZEY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |