C11H12FN3O5S — CID 107326949
1-(4-fluoro-2,6-dimethyl-3-nitrophenyl)sulfonylimidazolidin-2-one (PubChem CID 107326949) has the molecular formula C11H12FN3O5S and a molecular weight of 317.30 g/mol. Its IUPAC name is 1-(4-fluoro-2,6-dimethyl-3-nitrophenyl)sulfonylimidazolidin-2-one.
| Compound Name | 1-(4-fluoro-2,6-dimethyl-3-nitrophenyl)sulfonylimidazolidin-2-one |
|---|---|
| PubChem CID | 107326949 |
| Molecular Formula | C11H12FN3O5S |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-(4-fluoro-2,6-dimethyl-3-nitrophenyl)sulfonylimidazolidin-2-one |
| SMILES | Cc1cc(F)c([N+](=O)[O-])c(C)c1S(=O)(=O)N1CCNC1=O |
| InChI | InChI=1S/C11H12FN3O5S/c1-6-5-8(12)9(15(17)18)7(2)10(6)21(19,20)14-4-3-13-11(14)16/h5H,3-4H2,1-2H3,(H,13,16) |
| InChIKey | QMGOAVCUPQBIRZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|