C11H13BrN2O5S — CID 63363283
5-bromo-2-nitro-N-(oxan-3-yl)benzenesulfonamide (PubChem CID 63363283) has the molecular formula C11H13BrN2O5S and a molecular weight of 365.21 g/mol. Its IUPAC name is 5-bromo-2-nitro-N-(oxan-3-yl)benzenesulfonamide.
| Compound Name | 5-bromo-2-nitro-N-(oxan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 63363283 |
| Molecular Formula | C11H13BrN2O5S |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 5-bromo-2-nitro-N-(oxan-3-yl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Br)cc1S(=O)(=O)NC1CCCOC1 |
| InChI | InChI=1S/C11H13BrN2O5S/c12-8-3-4-10(14(15)16)11(6-8)20(17,18)13-9-2-1-5-19-7-9/h3-4,6,9,13H,1-2,5,7H2 |
| InChIKey | JJSAWQAGRLEFHL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|