C12H15BrN2O5S — CID 102609499
5-bromo-N-(3-ethoxycyclobutyl)-2-nitrobenzenesulfonamide (PubChem CID 102609499) has the molecular formula C12H15BrN2O5S and a molecular weight of 379.23 g/mol. Its IUPAC name is 5-bromo-N-(3-ethoxycyclobutyl)-2-nitrobenzenesulfonamide.
| Compound Name | 5-bromo-N-(3-ethoxycyclobutyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 102609499 |
| Molecular Formula | C12H15BrN2O5S |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 5-bromo-N-(3-ethoxycyclobutyl)-2-nitrobenzenesulfonamide |
| SMILES | CCOC1CC(NS(=O)(=O)c2cc(Br)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H15BrN2O5S/c1-2-20-10-6-9(7-10)14-21(18,19)12-5-8(13)3-4-11(12)15(16)17/h3-5,9-10,14H,2,6-7H2,1H3 |
| InChIKey | FYTYHAZYMSLOLG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|