C9H12BrN3O6S2 — CID 61016762
5-bromo-N-[2-(methanesulfonamido)ethyl]-2-nitrobenzenesulfonamide (PubChem CID 61016762) has the molecular formula C9H12BrN3O6S2 and a molecular weight of 402.25 g/mol. Its IUPAC name is 5-bromo-N-[2-(methanesulfonamido)ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | 5-bromo-N-[2-(methanesulfonamido)ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 61016762 |
| Molecular Formula | C9H12BrN3O6S2 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 400.94 |
| IUPAC Name | 5-bromo-N-[2-(methanesulfonamido)ethyl]-2-nitrobenzenesulfonamide |
| SMILES | CS(=O)(=O)NCCNS(=O)(=O)c1cc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12BrN3O6S2/c1-20(16,17)11-4-5-12-21(18,19)9-6-7(10)2-3-8(9)13(14)15/h2-3,6,11-12H,4-5H2,1H3 |
| InChIKey | HMJAWKXCULODRK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|