C11H10BrN3O4S2 — CID 62196825
5-bromo-2-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide (PubChem CID 62196825) has the molecular formula C11H10BrN3O4S2 and a molecular weight of 392.26 g/mol. Its IUPAC name is 5-bromo-2-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62196825 |
| Molecular Formula | C11H10BrN3O4S2 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 390.93 |
| IUPAC Name | 5-bromo-2-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Br)cc1S(=O)(=O)NCCc1nccs1 |
| InChI | InChI=1S/C11H10BrN3O4S2/c12-8-1-2-9(15(16)17)10(7-8)21(18,19)14-4-3-11-13-5-6-20-11/h1-2,5-7,14H,3-4H2 |
| InChIKey | DQHBTAPUZXVZTB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|