C9H11N5O4S3 — CID 80744778
5-hydrazinyl-4-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 80744778) has the molecular formula C9H11N5O4S3 and a molecular weight of 349.42 g/mol. Its IUPAC name is 5-hydrazinyl-4-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-hydrazinyl-4-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80744778 |
| Molecular Formula | C9H11N5O4S3 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 5-hydrazinyl-4-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | NNc1sc(S(=O)(=O)NCCc2nccs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N5O4S3/c10-13-9-6(14(15)16)5-8(20-9)21(17,18)12-2-1-7-11-3-4-19-7/h3-5,12-13H,1-2,10H2 |
| InChIKey | MJAJMHWYSOVJGJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|