C8H7BrN6O4S2 — CID 80745979
N-(5-bromopyrazin-2-yl)-5-hydrazinyl-4-nitrothiophene-2-sulfonamide (PubChem CID 80745979) has the molecular formula C8H7BrN6O4S2 and a molecular weight of 395.22 g/mol. Its IUPAC name is N-(5-bromopyrazin-2-yl)-5-hydrazinyl-4-nitrothiophene-2-sulfonamide.
| Compound Name | N-(5-bromopyrazin-2-yl)-5-hydrazinyl-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80745979 |
| Molecular Formula | C8H7BrN6O4S2 |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 393.92 |
| IUPAC Name | N-(5-bromopyrazin-2-yl)-5-hydrazinyl-4-nitrothiophene-2-sulfonamide |
| SMILES | NNc1sc(S(=O)(=O)Nc2cnc(Br)cn2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7BrN6O4S2/c9-5-2-12-6(3-11-5)14-21(18,19)7-1-4(15(16)17)8(13-10)20-7/h1-3,13H,10H2,(H,12,14) |
| InChIKey | UMRAPPOFHCYAHJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|