C10H11N5O4S2 — CID 80745589
5-hydrazinyl-N-(2-methyl-4-pyridinyl)-4-nitrothiophene-2-sulfonamide (PubChem CID 80745589) has the molecular formula C10H11N5O4S2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 5-hydrazinyl-N-(2-methyl-4-pyridinyl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-hydrazinyl-N-(2-methyl-4-pyridinyl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80745589 |
| Molecular Formula | C10H11N5O4S2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 5-hydrazinyl-N-(2-methyl-4-pyridinyl)-4-nitrothiophene-2-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc([N+](=O)[O-])c(NN)s2)ccn1 |
| InChI | InChI=1S/C10H11N5O4S2/c1-6-4-7(2-3-12-6)14-21(18,19)9-5-8(15(16)17)10(13-11)20-9/h2-5,13H,11H2,1H3,(H,12,14) |
| InChIKey | GUKWWVDHFATXIO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|