C8H14N4O6S3 — CID 80731405
N-[2-(methanesulfonamido)ethyl]-5-(methylamino)-4-nitrothiophene-2-sulfonamide (PubChem CID 80731405) has the molecular formula C8H14N4O6S3 and a molecular weight of 358.42 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)ethyl]-5-(methylamino)-4-nitrothiophene-2-sulfonamide.
| Compound Name | N-[2-(methanesulfonamido)ethyl]-5-(methylamino)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80731405 |
| Molecular Formula | C8H14N4O6S3 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | N-[2-(methanesulfonamido)ethyl]-5-(methylamino)-4-nitrothiophene-2-sulfonamide |
| SMILES | CNc1sc(S(=O)(=O)NCCNS(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N4O6S3/c1-9-8-6(12(13)14)5-7(19-8)21(17,18)11-4-3-10-20(2,15)16/h5,9-11H,3-4H2,1-2H3 |
| InChIKey | VSTPQBTUAHPAMX-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|