C10H16N4O5S2 — CID 80730943
N-[2-[[5-(ethylamino)-4-nitrothiophen-2-yl]sulfonylamino]ethyl]acetamide (PubChem CID 80730943) has the molecular formula C10H16N4O5S2 and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[2-[[5-(ethylamino)-4-nitrothiophen-2-yl]sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[[5-(ethylamino)-4-nitrothiophen-2-yl]sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 80730943 |
| Molecular Formula | C10H16N4O5S2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-[2-[[5-(ethylamino)-4-nitrothiophen-2-yl]sulfonylamino]ethyl]acetamide |
| SMILES | CCNc1sc(S(=O)(=O)NCCNC(C)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H16N4O5S2/c1-3-11-10-8(14(16)17)6-9(20-10)21(18,19)13-5-4-12-7(2)15/h6,11,13H,3-5H2,1-2H3,(H,12,15) |
| InChIKey | QUUWSRLTZRXXSB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|