C9H14N4O5S2 — CID 80747104
3-[[5-(ethylamino)-4-nitrothiophen-2-yl]sulfonylamino]propanamide (PubChem CID 80747104) has the molecular formula C9H14N4O5S2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-[[5-(ethylamino)-4-nitrothiophen-2-yl]sulfonylamino]propanamide.
| Compound Name | 3-[[5-(ethylamino)-4-nitrothiophen-2-yl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 80747104 |
| Molecular Formula | C9H14N4O5S2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 3-[[5-(ethylamino)-4-nitrothiophen-2-yl]sulfonylamino]propanamide |
| SMILES | CCNc1sc(S(=O)(=O)NCCC(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H14N4O5S2/c1-2-11-9-6(13(15)16)5-8(19-9)20(17,18)12-4-3-7(10)14/h5,11-12H,2-4H2,1H3,(H2,10,14) |
| InChIKey | JPMPECBKKRTDFZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|