C9H12ClN3O5S2 — CID 106235500
5-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]pentanamide (PubChem CID 106235500) has the molecular formula C9H12ClN3O5S2 and a molecular weight of 341.80 g/mol. Its IUPAC name is 5-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]pentanamide.
| Compound Name | 5-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 106235500 |
| Molecular Formula | C9H12ClN3O5S2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 5-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]pentanamide |
| SMILES | NC(=O)CCCCNS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C9H12ClN3O5S2/c10-9-6(13(15)16)5-8(19-9)20(17,18)12-4-2-1-3-7(11)14/h5,12H,1-4H2,(H2,11,14) |
| InChIKey | FFDFDCJXKNPCNO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|