C7H10ClN3O6S3 — CID 106336240
5-chloro-N-[2-(methylsulfamoyl)ethyl]-4-nitrothiophene-2-sulfonamide (PubChem CID 106336240) has the molecular formula C7H10ClN3O6S3 and a molecular weight of 363.83 g/mol. Its IUPAC name is 5-chloro-N-[2-(methylsulfamoyl)ethyl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(methylsulfamoyl)ethyl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106336240 |
| Molecular Formula | C7H10ClN3O6S3 |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | 5-chloro-N-[2-(methylsulfamoyl)ethyl]-4-nitrothiophene-2-sulfonamide |
| SMILES | CNS(=O)(=O)CCNS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C7H10ClN3O6S3/c1-9-19(14,15)3-2-10-20(16,17)6-4-5(11(12)13)7(8)18-6/h4,9-10H,2-3H2,1H3 |
| InChIKey | GBXJEMUULWVWBG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|