C9H12F3N3O4S2 — CID 80731137
5-(ethylamino)-4-nitro-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide (PubChem CID 80731137) has the molecular formula C9H12F3N3O4S2 and a molecular weight of 347.34 g/mol. Its IUPAC name is 5-(ethylamino)-4-nitro-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide.
| Compound Name | 5-(ethylamino)-4-nitro-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80731137 |
| Molecular Formula | C9H12F3N3O4S2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 5-(ethylamino)-4-nitro-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide |
| SMILES | CCNc1sc(S(=O)(=O)NCCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12F3N3O4S2/c1-2-13-8-6(15(16)17)5-7(20-8)21(18,19)14-4-3-9(10,11)12/h5,13-14H,2-4H2,1H3 |
| InChIKey | LLKQKWVSGUNDLT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|