C8H9N5O4S3 — CID 80747085
5-(ethylamino)-4-nitro-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide (PubChem CID 80747085) has the molecular formula C8H9N5O4S3 and a molecular weight of 335.39 g/mol. Its IUPAC name is 5-(ethylamino)-4-nitro-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-(ethylamino)-4-nitro-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80747085 |
| Molecular Formula | C8H9N5O4S3 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 5-(ethylamino)-4-nitro-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide |
| SMILES | CCNc1sc(S(=O)(=O)Nc2nncs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9N5O4S3/c1-2-9-7-5(13(14)15)3-6(19-7)20(16,17)12-8-11-10-4-18-8/h3-4,9H,2H2,1H3,(H,11,12) |
| InChIKey | TUSIWWCYJFLHNL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|