C10H11Cl2N3O5S — CID 100613309
N-[2-[(2,4-dichloro-5-nitrophenyl)sulfonylamino]ethyl]acetamide (PubChem CID 100613309) has the molecular formula C10H11Cl2N3O5S and a molecular weight of 356.19 g/mol. Its IUPAC name is N-[2-[(2,4-dichloro-5-nitrophenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[(2,4-dichloro-5-nitrophenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 100613309 |
| Molecular Formula | C10H11Cl2N3O5S |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | N-[2-[(2,4-dichloro-5-nitrophenyl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O5S/c1-6(16)13-2-3-14-21(19,20)10-5-9(15(17)18)7(11)4-8(10)12/h4-5,14H,2-3H2,1H3,(H,13,16) |
| InChIKey | XEUWCKMQSFVMKC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|