C7H11N5O5S2 — CID 83114819
2-[(5-amino-4-nitrothiophen-2-yl)sulfonylamino]ethylurea (PubChem CID 83114819) has the molecular formula C7H11N5O5S2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-[(5-amino-4-nitrothiophen-2-yl)sulfonylamino]ethylurea.
| Compound Name | 2-[(5-amino-4-nitrothiophen-2-yl)sulfonylamino]ethylurea |
|---|---|
| PubChem CID | 83114819 |
| Molecular Formula | C7H11N5O5S2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-[(5-amino-4-nitrothiophen-2-yl)sulfonylamino]ethylurea |
| SMILES | NC(=O)NCCNS(=O)(=O)c1cc([N+](=O)[O-])c(N)s1 |
| InChI | InChI=1S/C7H11N5O5S2/c8-6-4(12(14)15)3-5(18-6)19(16,17)11-2-1-10-7(9)13/h3,11H,1-2,8H2,(H3,9,10,13) |
| InChIKey | MENSDACFCOTBJU-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 170.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|