C11H17N3O4S3 — CID 80728268
5-(methylamino)-4-nitro-N-(thian-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 80728268) has the molecular formula C11H17N3O4S3 and a molecular weight of 351.48 g/mol. Its IUPAC name is 5-(methylamino)-4-nitro-N-(thian-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-(methylamino)-4-nitro-N-(thian-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80728268 |
| Molecular Formula | C11H17N3O4S3 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 5-(methylamino)-4-nitro-N-(thian-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | CNc1sc(S(=O)(=O)NCC2CCCCS2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N3O4S3/c1-12-11-9(14(15)16)6-10(20-11)21(17,18)13-7-8-4-2-3-5-19-8/h6,8,12-13H,2-5,7H2,1H3 |
| InChIKey | LALUEZRKOHQUGW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|