C9H11BrN4O5S — CID 83110096
2-[(5-bromo-2-nitrophenyl)sulfonylamino]ethylurea (PubChem CID 83110096) has the molecular formula C9H11BrN4O5S and a molecular weight of 367.18 g/mol. Its IUPAC name is 2-[(5-bromo-2-nitrophenyl)sulfonylamino]ethylurea.
| Compound Name | 2-[(5-bromo-2-nitrophenyl)sulfonylamino]ethylurea |
|---|---|
| PubChem CID | 83110096 |
| Molecular Formula | C9H11BrN4O5S |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 2-[(5-bromo-2-nitrophenyl)sulfonylamino]ethylurea |
| SMILES | NC(=O)NCCNS(=O)(=O)c1cc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11BrN4O5S/c10-6-1-2-7(14(16)17)8(5-6)20(18,19)13-4-3-12-9(11)15/h1-2,5,13H,3-4H2,(H3,11,12,15) |
| InChIKey | IJASJZTUQBJUMZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|