C10H15FN4O5S — CID 62335849
2-fluoro-6-hydrazinyl-N-(2-hydroxypropyl)-N-methyl-4-nitrobenzenesulfonamide (PubChem CID 62335849) has the molecular formula C10H15FN4O5S and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-fluoro-6-hydrazinyl-N-(2-hydroxypropyl)-N-methyl-4-nitrobenzenesulfonamide.
| Compound Name | 2-fluoro-6-hydrazinyl-N-(2-hydroxypropyl)-N-methyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62335849 |
| Molecular Formula | C10H15FN4O5S |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-fluoro-6-hydrazinyl-N-(2-hydroxypropyl)-N-methyl-4-nitrobenzenesulfonamide |
| SMILES | CC(O)CN(C)S(=O)(=O)c1c(F)cc([N+](=O)[O-])cc1NN |
| InChI | InChI=1S/C10H15FN4O5S/c1-6(16)5-14(2)21(19,20)10-8(11)3-7(15(17)18)4-9(10)13-12/h3-4,6,13,16H,5,12H2,1-2H3 |
| InChIKey | OWWCXYUFMQIQBI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 138.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|