C8H14N4O5S2 — CID 80741936
5-hydrazinyl-N-(2-hydroxypropyl)-N-methyl-4-nitrothiophene-2-sulfonamide (PubChem CID 80741936) has the molecular formula C8H14N4O5S2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 5-hydrazinyl-N-(2-hydroxypropyl)-N-methyl-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-hydrazinyl-N-(2-hydroxypropyl)-N-methyl-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80741936 |
| Molecular Formula | C8H14N4O5S2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 5-hydrazinyl-N-(2-hydroxypropyl)-N-methyl-4-nitrothiophene-2-sulfonamide |
| SMILES | CC(O)CN(C)S(=O)(=O)c1cc([N+](=O)[O-])c(NN)s1 |
| InChI | InChI=1S/C8H14N4O5S2/c1-5(13)4-11(2)19(16,17)7-3-6(12(14)15)8(10-9)18-7/h3,5,10,13H,4,9H2,1-2H3 |
| InChIKey | XBHAILVFESFJOI-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 138.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|