C9H14N4O4S3 — CID 80741598
5-hydrazinyl-N-methyl-4-nitro-N-(thiolan-3-yl)thiophene-2-sulfonamide (PubChem CID 80741598) has the molecular formula C9H14N4O4S3 and a molecular weight of 338.44 g/mol. Its IUPAC name is 5-hydrazinyl-N-methyl-4-nitro-N-(thiolan-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-hydrazinyl-N-methyl-4-nitro-N-(thiolan-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80741598 |
| Molecular Formula | C9H14N4O4S3 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 5-hydrazinyl-N-methyl-4-nitro-N-(thiolan-3-yl)thiophene-2-sulfonamide |
| SMILES | CN(C1CCSC1)S(=O)(=O)c1cc([N+](=O)[O-])c(NN)s1 |
| InChI | InChI=1S/C9H14N4O4S3/c1-12(6-2-3-18-5-6)20(16,17)8-4-7(13(14)15)9(11-10)19-8/h4,6,11H,2-3,5,10H2,1H3 |
| InChIKey | POQCBAKHKPHSBQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|